C13H21Cl2NO — CID 19018464
1,2-dichloro-4-(ethoxymethyl)benzene;N-ethylethanamine (PubChem CID 19018464) has the molecular formula C13H21Cl2NO and a molecular weight of 278.22 g/mol. Its IUPAC name is 1,2-dichloro-4-(ethoxymethyl)benzene;N-ethylethanamine.
| Compound Name | 1,2-dichloro-4-(ethoxymethyl)benzene;N-ethylethanamine |
|---|---|
| PubChem CID | 19018464 |
| Molecular Formula | C13H21Cl2NO |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1,2-dichloro-4-(ethoxymethyl)benzene;N-ethylethanamine |
| SMILES | CCNCC.CCOCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2O.C4H11N/c1-2-12-6-7-3-4-8(10)9(11)5-7;1-3-5-4-2/h3-5H,2,6H2,1H3;5H,3-4H2,1-2H3 |
| InChIKey | ZQMKHCZXMZUDMM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |