C22H32Cl2N+ — CID 54019845
(3,4-dichlorophenyl)methyl-dimethyl-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]azanium (PubChem CID 54019845) has the molecular formula C22H32Cl2N+ and a molecular weight of 381.41 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl-dimethyl-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]azanium.
| Compound Name | (3,4-dichlorophenyl)methyl-dimethyl-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]azanium |
|---|---|
| PubChem CID | 54019845 |
| Molecular Formula | C22H32Cl2N+ |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (3,4-dichlorophenyl)methyl-dimethyl-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]azanium |
| SMILES | CC1=CCCC(C)(C)C1C=CC(C)[N+](C)(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H32Cl2N/c1-16-8-7-13-22(3,4)19(16)11-9-17(2)25(5,6)15-18-10-12-20(23)21(24)14-18/h8-12,14,17,19H,7,13,15H2,1-6H3/q+1 |
| InChIKey | KYEFTMCIWNFJOP-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|