C27H40ClN5O2S — CID 10324818
2-[4-[3-(5-chloro-2-phenylsulfanylanilino)propyl]piperazin-1-yl]ethyl 2,6-diaminohexanoate (PubChem CID 10324818) has the molecular formula C27H40ClN5O2S and a molecular weight of 534.17 g/mol. Its IUPAC name is 2-[4-[3-(5-chloro-2-phenylsulfanylanilino)propyl]piperazin-1-yl]ethyl 2,6-diaminohexanoate.
| Compound Name | 2-[4-[3-(5-chloro-2-phenylsulfanylanilino)propyl]piperazin-1-yl]ethyl 2,6-diaminohexanoate |
|---|---|
| PubChem CID | 10324818 |
| Molecular Formula | C27H40ClN5O2S |
| Molecular Weight | 534.17 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 2-[4-[3-(5-chloro-2-phenylsulfanylanilino)propyl]piperazin-1-yl]ethyl 2,6-diaminohexanoate |
| SMILES | NCCCCC(N)C(=O)OCCN1CCN(CCCNc2cc(Cl)ccc2Sc2ccccc2)CC1 |
| InChI | InChI=1S/C27H40ClN5O2S/c28-22-10-11-26(36-23-7-2-1-3-8-23)25(21-22)31-13-6-14-32-15-17-33(18-16-32)19-20-35-27(34)24(30)9-4-5-12-29/h1-3,7-8,10-11,21,24,31H,4-6,9,12-20,29-30H2 |
| InChIKey | QGHGXTZQAGSYNM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.17 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|