C20H24N4O2S — CID 108515107
2-[4-(2-aminoethyl)piperazin-1-yl]-2-oxo-N-(2-phenylsulfanylphenyl)acetamide (PubChem CID 108515107) has the molecular formula C20H24N4O2S and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)piperazin-1-yl]-2-oxo-N-(2-phenylsulfanylphenyl)acetamide.
| Compound Name | 2-[4-(2-aminoethyl)piperazin-1-yl]-2-oxo-N-(2-phenylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 108515107 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-[4-(2-aminoethyl)piperazin-1-yl]-2-oxo-N-(2-phenylsulfanylphenyl)acetamide |
| SMILES | NCCN1CCN(C(=O)C(=O)Nc2ccccc2Sc2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N4O2S/c21-10-11-23-12-14-24(15-13-23)20(26)19(25)22-17-8-4-5-9-18(17)27-16-6-2-1-3-7-16/h1-9H,10-15,21H2,(H,22,25) |
| InChIKey | VPNKOTSWWLKESI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|