C15H21N5O3 — CID 108517914
2-amino-N-[2-[4-(2-aminoethyl)piperazin-1-yl]-2-oxoacetyl]benzamide (PubChem CID 108517914) has the molecular formula C15H21N5O3 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-amino-N-[2-[4-(2-aminoethyl)piperazin-1-yl]-2-oxoacetyl]benzamide.
| Compound Name | 2-amino-N-[2-[4-(2-aminoethyl)piperazin-1-yl]-2-oxoacetyl]benzamide |
|---|---|
| PubChem CID | 108517914 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-amino-N-[2-[4-(2-aminoethyl)piperazin-1-yl]-2-oxoacetyl]benzamide |
| SMILES | NCCN1CCN(C(=O)C(=O)NC(=O)c2ccccc2N)CC1 |
| InChI | InChI=1S/C15H21N5O3/c16-5-6-19-7-9-20(10-8-19)15(23)14(22)18-13(21)11-3-1-2-4-12(11)17/h1-4H,5-10,16-17H2,(H,18,21,22) |
| InChIKey | JONJNLXIBGKYHG-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|