C16H21N3O3 — CID 108524895
2-amino-N-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoacetyl]benzamide (PubChem CID 108524895) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-amino-N-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoacetyl]benzamide.
| Compound Name | 2-amino-N-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoacetyl]benzamide |
|---|---|
| PubChem CID | 108524895 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-amino-N-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoacetyl]benzamide |
| SMILES | CC1CCCC(C)N1C(=O)C(=O)NC(=O)c1ccccc1N |
| InChI | InChI=1S/C16H21N3O3/c1-10-6-5-7-11(2)19(10)16(22)15(21)18-14(20)12-8-3-4-9-13(12)17/h3-4,8-11H,5-7,17H2,1-2H3,(H,18,20,21) |
| InChIKey | HMAAJGGKVJCBNY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|