C20H25Cl2N3S — CID 25172586
5-chloro-2-(4-chlorophenyl)sulfanyl-N-[3-(4-methylpiperazin-1-yl)propyl]aniline (PubChem CID 25172586) has the molecular formula C20H25Cl2N3S and a molecular weight of 410.41 g/mol. Its IUPAC name is 5-chloro-2-(4-chlorophenyl)sulfanyl-N-[3-(4-methylpiperazin-1-yl)propyl]aniline.
| Compound Name | 5-chloro-2-(4-chlorophenyl)sulfanyl-N-[3-(4-methylpiperazin-1-yl)propyl]aniline |
|---|---|
| PubChem CID | 25172586 |
| Molecular Formula | C20H25Cl2N3S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 5-chloro-2-(4-chlorophenyl)sulfanyl-N-[3-(4-methylpiperazin-1-yl)propyl]aniline |
| SMILES | CN1CCN(CCCNc2cc(Cl)ccc2Sc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H25Cl2N3S/c1-24-11-13-25(14-12-24)10-2-9-23-19-15-17(22)5-8-20(19)26-18-6-3-16(21)4-7-18/h3-8,15,23H,2,9-14H2,1H3 |
| InChIKey | LHCILDQFBZMULI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|