C44H48N6O2+2 — CID 70877087
2-cyano-N-[3-[4-[3-[(2-cyano-3,3-diphenylprop-2-enoyl)amino]propyl]-1,4-dimethylpiperazine-1,4-diium-1-yl]propyl]-3,3-diphenylprop-2-enamide (PubChem CID 70877087) has the molecular formula C44H48N6O2+2 and a molecular weight of 692.91 g/mol. Its IUPAC name is 2-cyano-N-[3-[4-[3-[(2-cyano-3,3-diphenylprop-2-enoyl)amino]propyl]-1,4-dimethylpiperazine-1,4-diium-1-yl]propyl]-3,3-diphenylprop-2-enamide.
| Compound Name | 2-cyano-N-[3-[4-[3-[(2-cyano-3,3-diphenylprop-2-enoyl)amino]propyl]-1,4-dimethylpiperazine-1,4-diium-1-yl]propyl]-3,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 70877087 |
| Molecular Formula | C44H48N6O2+2 |
| Molecular Weight | 692.91 g/mol |
| Exact Mass | 692.38 |
| IUPAC Name | 2-cyano-N-[3-[4-[3-[(2-cyano-3,3-diphenylprop-2-enoyl)amino]propyl]-1,4-dimethylpiperazine-1,4-diium-1-yl]propyl]-3,3-diphenylprop-2-enamide |
| SMILES | C[N+]1(CCCNC(=O)C(C#N)=C(c2ccccc2)c2ccccc2)CC[N+](C)(CCCNC(=O)C(C#N)=C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C44H46N6O2/c1-49(27-15-25-47-43(51)39(33-45)41(35-17-7-3-8-18-35)36-19-9-4-10-20-36)29-31-50(2,32-30-49)28-16-26-48-44(52)40(34-46)42(37-21-11-5-12-22-37)38-23-13-6-14-24-38/h3-14,17-24H,15-16,25-32H2,1-2H3/p+2 |
| InChIKey | BZVNNYIPMXRLSJ-UHFFFAOYSA-P |
| XLogP | 5.96 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.91 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|