C25H24N4O4 — CID 156532600
2-cyano-N-[2-[3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoylamino]ethyl]-3,3-diphenylprop-2-enamide (PubChem CID 156532600) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-cyano-N-[2-[3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoylamino]ethyl]-3,3-diphenylprop-2-enamide.
| Compound Name | 2-cyano-N-[2-[3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoylamino]ethyl]-3,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 156532600 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-cyano-N-[2-[3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoylamino]ethyl]-3,3-diphenylprop-2-enamide |
| SMILES | N#CC(C(=O)NCCNC(=O)CCN1C(=O)C=CC1O)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24N4O4/c26-17-20(24(18-7-3-1-4-8-18)19-9-5-2-6-10-19)25(33)28-15-14-27-21(30)13-16-29-22(31)11-12-23(29)32/h1-12,22,31H,13-16H2,(H,27,30)(H,28,33) |
| InChIKey | DLBLQMAIIADVMQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|