C30H22N2O5 — CID 98121546
ethyl (E)-2-cyano-3-[4-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]phenyl]-3-hydroxyprop-2-enoate (PubChem CID 98121546) has the molecular formula C30H22N2O5 and a molecular weight of 490.52 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[4-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]phenyl]-3-hydroxyprop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[4-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]phenyl]-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 98121546 |
| Molecular Formula | C30H22N2O5 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | ethyl (E)-2-cyano-3-[4-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]phenyl]-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C(/O)c1ccc(N2C(=O)[C@@H]3C4c5ccccc5C(c5ccccc54)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C30H22N2O5/c1-2-37-30(36)22(15-31)27(33)16-11-13-17(14-12-16)32-28(34)25-23-18-7-3-4-8-19(18)24(26(25)29(32)35)21-10-6-5-9-20(21)23/h3-14,23-26,33H,2H2,1H3/b27-22+/t23?,24?,25-,26+ |
| InChIKey | LLXYQOQESHNDOF-GKYHQDMGSA-N |
| XLogP | 4.44 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|