C21H18Br2N2O5 — CID 124774966
ethyl (Z)-2-cyano-3-[4-[(1R,2R,6S,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]-3-hydroxyprop-2-enoate (PubChem CID 124774966) has the molecular formula C21H18Br2N2O5 and a molecular weight of 538.19 g/mol. Its IUPAC name is ethyl (Z)-2-cyano-3-[4-[(1R,2R,6S,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]-3-hydroxyprop-2-enoate.
| Compound Name | ethyl (Z)-2-cyano-3-[4-[(1R,2R,6S,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 124774966 |
| Molecular Formula | C21H18Br2N2O5 |
| Molecular Weight | 538.19 g/mol |
| Exact Mass | 535.96 |
| IUPAC Name | ethyl (Z)-2-cyano-3-[4-[(1R,2R,6S,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C(\O)c1ccc(N2C(=O)[C@@H]3[C@H]4C[C@@H]([C@H](Br)[C@@H]4Br)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C21H18Br2N2O5/c1-2-30-21(29)13(8-24)18(26)9-3-5-10(6-4-9)25-19(27)14-11-7-12(15(14)20(25)28)17(23)16(11)22/h3-6,11-12,14-17,26H,2,7H2,1H3/b18-13-/t11-,12-,14-,15+,16-,17+/m1/s1 |
| InChIKey | RXFIZNCDBFGLRW-GFVAIRONSA-N |
| XLogP | 3.32 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|