About lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride
lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride (PubChem CID 173049785) has the molecular formula C13H12LiNO4
and a molecular weight of 253.18 g/mol. Its IUPAC name is lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride.
Molecular Properties
| Compound Name | lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride |
| PubChem CID | 173049785 |
| Molecular Formula | C13H12LiNO4 |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride |
| SMILES | CCOC(=O)C(=O)C=C(O)c1cccc(C#N)c1.[H-].[Li+] |
| InChI | InChI=1S/C13H11NO4.Li.H/c1-2-18-13(17)12(16)7-11(15)10-5-3-4-9(6-10)8-14;;/h3-7,15H,2H2,1H3;;/q;+1;-1 |
| InChIKey | UKPMOUCFJNJSDC-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride?
The IUPAC name of lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride (CID 173049785) is lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride.
What is the SMILES notation for lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride?
The canonical SMILES for lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride is CCOC(=O)C(=O)C=C(O)c1cccc(C#N)c1.[H-].[Li+].
What is the InChIKey of lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride?
The InChIKey is UKPMOUCFJNJSDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO4.Li.H/c1-2-18-13(17)12(16)7-11(15)10-5-3-4-9(6-10)8-14;;/h3-7,15H,2H2,1H3;;/q;+1;-1.
What are the key properties of lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride?
lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride has a molecular weight of 253.18 g/mol, XLogP of -1.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;ethyl 4-(3-cyanophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride is sourced from PubChem (CID 173049785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).