C20H17F3O3 — CID 87598556
(2E,4Z)-5-(2-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid (PubChem CID 87598556) has the molecular formula C20H17F3O3 and a molecular weight of 362.35 g/mol. Its IUPAC name is (2E,4Z)-5-(2-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid.
| Compound Name | (2E,4Z)-5-(2-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 87598556 |
| Molecular Formula | C20H17F3O3 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (2E,4Z)-5-(2-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
| SMILES | CCOc1ccccc1/C(=C\C=C\C(=O)O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F3O3/c1-2-26-18-8-4-3-6-17(18)16(7-5-9-19(24)25)14-10-12-15(13-11-14)20(21,22)23/h3-13H,2H2,1H3,(H,24,25)/b9-5+,16-7- |
| InChIKey | AOCMJHQCRWRJCY-UCCOOYPFSA-N |
| XLogP | 5.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|