C19H16ClFO4 — CID 46702898
(2E,4Z)-5-chloro-5-(4-fluorophenyl)-1-(2-hydroxy-4,6-dimethoxyphenyl)penta-2,4-dien-1-one (PubChem CID 46702898) has the molecular formula C19H16ClFO4 and a molecular weight of 362.78 g/mol. Its IUPAC name is (2E,4Z)-5-chloro-5-(4-fluorophenyl)-1-(2-hydroxy-4,6-dimethoxyphenyl)penta-2,4-dien-1-one.
| Compound Name | (2E,4Z)-5-chloro-5-(4-fluorophenyl)-1-(2-hydroxy-4,6-dimethoxyphenyl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 46702898 |
| Molecular Formula | C19H16ClFO4 |
| Molecular Weight | 362.78 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | (2E,4Z)-5-chloro-5-(4-fluorophenyl)-1-(2-hydroxy-4,6-dimethoxyphenyl)penta-2,4-dien-1-one |
| SMILES | COc1cc(O)c(C(=O)/C=C/C=C(\Cl)c2ccc(F)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H16ClFO4/c1-24-14-10-17(23)19(18(11-14)25-2)16(22)5-3-4-15(20)12-6-8-13(21)9-7-12/h3-11,23H,1-2H3/b5-3+,15-4- |
| InChIKey | ZSJPCUMKXAOTBV-MUKQYHNNSA-N |
| XLogP | 4.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.78 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|