C20H17FN2O4 — CID 151234813
(3,5-diaminophenyl)-[4-(4-fluorophenoxy)-2-hydroxy-6-methoxyphenyl]methanone (PubChem CID 151234813) has the molecular formula C20H17FN2O4 and a molecular weight of 368.36 g/mol. Its IUPAC name is (3,5-diaminophenyl)-[4-(4-fluorophenoxy)-2-hydroxy-6-methoxyphenyl]methanone.
| Compound Name | (3,5-diaminophenyl)-[4-(4-fluorophenoxy)-2-hydroxy-6-methoxyphenyl]methanone |
|---|---|
| PubChem CID | 151234813 |
| Molecular Formula | C20H17FN2O4 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (3,5-diaminophenyl)-[4-(4-fluorophenoxy)-2-hydroxy-6-methoxyphenyl]methanone |
| SMILES | COc1cc(Oc2ccc(F)cc2)cc(O)c1C(=O)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C20H17FN2O4/c1-26-18-10-16(27-15-4-2-12(21)3-5-15)9-17(24)19(18)20(25)11-6-13(22)8-14(23)7-11/h2-10,24H,22-23H2,1H3 |
| InChIKey | NPAXGYGVQJFFQR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|