C17H17IO6 — CID 72947607
(2-hydroxy-4,6-dimethoxyphenyl)-(2-iodo-4,5-dimethoxyphenyl)methanone (PubChem CID 72947607) has the molecular formula C17H17IO6 and a molecular weight of 444.22 g/mol. Its IUPAC name is (2-hydroxy-4,6-dimethoxyphenyl)-(2-iodo-4,5-dimethoxyphenyl)methanone.
| Compound Name | (2-hydroxy-4,6-dimethoxyphenyl)-(2-iodo-4,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 72947607 |
| Molecular Formula | C17H17IO6 |
| Molecular Weight | 444.22 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | (2-hydroxy-4,6-dimethoxyphenyl)-(2-iodo-4,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(O)c(C(=O)c2cc(OC)c(OC)cc2I)c(OC)c1 |
| InChI | InChI=1S/C17H17IO6/c1-21-9-5-12(19)16(15(6-9)24-4)17(20)10-7-13(22-2)14(23-3)8-11(10)18/h5-8,19H,1-4H3 |
| InChIKey | YELPDSOMTPPKRW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|