C16H20N2O4 — CID 21188202
4-aminobenzamide;5-tert-butylfuran-2-carboxylic acid (PubChem CID 21188202) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 4-aminobenzamide;5-tert-butylfuran-2-carboxylic acid.
| Compound Name | 4-aminobenzamide;5-tert-butylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 21188202 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 4-aminobenzamide;5-tert-butylfuran-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)O)o1.NC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C9H12O3.C7H8N2O/c1-9(2,3)7-5-4-6(12-7)8(10)11;8-6-3-1-5(2-4-6)7(9)10/h4-5H,1-3H3,(H,10,11);1-4H,8H2,(H2,9,10) |
| InChIKey | BGBWDJARAZHDIN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|