4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid

C13H12F2N2O4 — CID 70189415

IUPAC4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid
SMILESNC(=O)c1ccc(N)cc1.O=C(O)c1ccc(C(F)F)o1
InChIInChI=1S/C7H8N2O.C6H4F2O3/c8-6-3-1-5(2-4-6)7(9)10;7-5(8)3-1-2-4(11-3)6(9)10/h1-4H,8H2,(H2,9,10);1-2,5H,(H,9,10)
InChIKeyYBGHHCLHDSBDIH-UHFFFAOYSA-N
MW298.25 g/mol
LogP2.28
Rot. Bonds3

About 4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid

4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid (PubChem CID 70189415) has the molecular formula C13H12F2N2O4 and a molecular weight of 298.25 g/mol. Its IUPAC name is 4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid.

Molecular Properties

Compound Name4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid
PubChem CID70189415
Molecular FormulaC13H12F2N2O4
Molecular Weight298.25 g/mol
Exact Mass298.08
IUPAC Name4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid
SMILESNC(=O)c1ccc(N)cc1.O=C(O)c1ccc(C(F)F)o1
InChIInChI=1S/C7H8N2O.C6H4F2O3/c8-6-3-1-5(2-4-6)7(9)10;7-5(8)3-1-2-4(11-3)6(9)10/h1-4H,8H2,(H2,9,10);1-2,5H,(H,9,10)
InChIKeyYBGHHCLHDSBDIH-UHFFFAOYSA-N
XLogP2.28
TPSA119.55 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.25
LogP ≤ 52.28
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid?
The IUPAC name of 4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid (CID 70189415) is 4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid.
What is the SMILES notation for 4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid?
The canonical SMILES for 4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid is NC(=O)c1ccc(N)cc1.O=C(O)c1ccc(C(F)F)o1.
What is the InChIKey of 4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid?
The InChIKey is YBGHHCLHDSBDIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C6H4F2O3/c8-6-3-1-5(2-4-6)7(9)10;7-5(8)3-1-2-4(11-3)6(9)10/h1-4H,8H2,(H2,9,10);1-2,5H,(H,9,10).
What are the key properties of 4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid?
4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid has a molecular weight of 298.25 g/mol, XLogP of 2.28, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid is sourced from PubChem (CID 70189415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).