C13H12F2N2O4 — CID 70189415
4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid (PubChem CID 70189415) has the molecular formula C13H12F2N2O4 and a molecular weight of 298.25 g/mol. Its IUPAC name is 4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid.
| Compound Name | 4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 70189415 |
| Molecular Formula | C13H12F2N2O4 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-aminobenzamide;5-(difluoromethyl)furan-2-carboxylic acid |
| SMILES | NC(=O)c1ccc(N)cc1.O=C(O)c1ccc(C(F)F)o1 |
| InChI | InChI=1S/C7H8N2O.C6H4F2O3/c8-6-3-1-5(2-4-6)7(9)10;7-5(8)3-1-2-4(11-3)6(9)10/h1-4H,8H2,(H2,9,10);1-2,5H,(H,9,10) |
| InChIKey | YBGHHCLHDSBDIH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|