C16H13ClN2O3S2 — CID 17225028
N-(1,3-benzothiazol-2-yl)-2-[(4-chlorophenyl)methylsulfonyl]acetamide (PubChem CID 17225028) has the molecular formula C16H13ClN2O3S2 and a molecular weight of 380.88 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[(4-chlorophenyl)methylsulfonyl]acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[(4-chlorophenyl)methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 17225028 |
| Molecular Formula | C16H13ClN2O3S2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[(4-chlorophenyl)methylsulfonyl]acetamide |
| SMILES | O=C(CS(=O)(=O)Cc1ccc(Cl)cc1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H13ClN2O3S2/c17-12-7-5-11(6-8-12)9-24(21,22)10-15(20)19-16-18-13-3-1-2-4-14(13)23-16/h1-8H,9-10H2,(H,18,19,20) |
| InChIKey | DZZGREWWHUGHAL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |