C22H19BrFNO3S — CID 112827216
2-[(4-bromophenyl)methylsulfonyl]-N-[(4-fluorophenyl)-phenylmethyl]acetamide (PubChem CID 112827216) has the molecular formula C22H19BrFNO3S and a molecular weight of 476.37 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylsulfonyl]-N-[(4-fluorophenyl)-phenylmethyl]acetamide.
| Compound Name | 2-[(4-bromophenyl)methylsulfonyl]-N-[(4-fluorophenyl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 112827216 |
| Molecular Formula | C22H19BrFNO3S |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfonyl]-N-[(4-fluorophenyl)-phenylmethyl]acetamide |
| SMILES | O=C(CS(=O)(=O)Cc1ccc(Br)cc1)NC(c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H19BrFNO3S/c23-19-10-6-16(7-11-19)14-29(27,28)15-21(26)25-22(17-4-2-1-3-5-17)18-8-12-20(24)13-9-18/h1-13,22H,14-15H2,(H,25,26) |
| InChIKey | AGKUZYXOTLYTQQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |