C22H19BrFNO4S — CID 112826367
2-[(4-bromophenyl)methylsulfonyl]-N-[3-[(4-fluorophenyl)methoxy]phenyl]acetamide (PubChem CID 112826367) has the molecular formula C22H19BrFNO4S and a molecular weight of 492.37 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylsulfonyl]-N-[3-[(4-fluorophenyl)methoxy]phenyl]acetamide.
| Compound Name | 2-[(4-bromophenyl)methylsulfonyl]-N-[3-[(4-fluorophenyl)methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 112826367 |
| Molecular Formula | C22H19BrFNO4S |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfonyl]-N-[3-[(4-fluorophenyl)methoxy]phenyl]acetamide |
| SMILES | O=C(CS(=O)(=O)Cc1ccc(Br)cc1)Nc1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H19BrFNO4S/c23-18-8-4-17(5-9-18)14-30(27,28)15-22(26)25-20-2-1-3-21(12-20)29-13-16-6-10-19(24)11-7-16/h1-12H,13-15H2,(H,25,26) |
| InChIKey | QZGQHKPIPQDEIJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |