C17H15BrF3NO3S — CID 112826325
2-[(4-bromophenyl)methylsulfonyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 112826325) has the molecular formula C17H15BrF3NO3S and a molecular weight of 450.28 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylsulfonyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(4-bromophenyl)methylsulfonyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 112826325 |
| Molecular Formula | C17H15BrF3NO3S |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfonyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CS(=O)(=O)Cc2ccc(Br)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H15BrF3NO3S/c1-11-2-7-14(8-15(11)17(19,20)21)22-16(23)10-26(24,25)9-12-3-5-13(18)6-4-12/h2-8H,9-10H2,1H3,(H,22,23) |
| InChIKey | LWRMROPUHYEVRM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |