C11H13F3N2O3S — CID 122141465
2-(methylsulfamoyl)-N-[3-methyl-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 122141465) has the molecular formula C11H13F3N2O3S and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-(methylsulfamoyl)-N-[3-methyl-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(methylsulfamoyl)-N-[3-methyl-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 122141465 |
| Molecular Formula | C11H13F3N2O3S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-(methylsulfamoyl)-N-[3-methyl-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CNS(=O)(=O)CC(=O)Nc1ccc(C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C11H13F3N2O3S/c1-7-5-8(3-4-9(7)11(12,13)14)16-10(17)6-20(18,19)15-2/h3-5,15H,6H2,1-2H3,(H,16,17) |
| InChIKey | XQYLKGCBDJMLMH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |