C17H14FN5O4 — CID 51119178
N-[3-[(4-fluorophenyl)methoxy]phenyl]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 51119178) has the molecular formula C17H14FN5O4 and a molecular weight of 371.33 g/mol. Its IUPAC name is N-[3-[(4-fluorophenyl)methoxy]phenyl]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[3-[(4-fluorophenyl)methoxy]phenyl]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 51119178 |
| Molecular Formula | C17H14FN5O4 |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N-[3-[(4-fluorophenyl)methoxy]phenyl]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)Nc1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H14FN5O4/c18-13-6-4-12(5-7-13)10-27-15-3-1-2-14(8-15)20-16(24)9-22-11-19-17(21-22)23(25)26/h1-8,11H,9-10H2,(H,20,24) |
| InChIKey | CNGSKEMJSAHCTI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|