C20H19FN4O4 — CID 34607878
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[3-[(4-fluorophenyl)methoxy]phenyl]acetamide (PubChem CID 34607878) has the molecular formula C20H19FN4O4 and a molecular weight of 398.39 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[3-[(4-fluorophenyl)methoxy]phenyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[3-[(4-fluorophenyl)methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 34607878 |
| Molecular Formula | C20H19FN4O4 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[3-[(4-fluorophenyl)methoxy]phenyl]acetamide |
| SMILES | Cc1nn(CC(=O)Nc2cccc(OCc3ccc(F)cc3)c2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19FN4O4/c1-13-20(25(27)28)14(2)24(23-13)11-19(26)22-17-4-3-5-18(10-17)29-12-15-6-8-16(21)9-7-15/h3-10H,11-12H2,1-2H3,(H,22,26) |
| InChIKey | RSVDAKCNHKRAMB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|