C17H23N3O5S — CID 59722434
methyl (2R)-2-[[4-[(2-acetamidoacetyl)amino]benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 59722434) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is methyl (2R)-2-[[4-[(2-acetamidoacetyl)amino]benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2R)-2-[[4-[(2-acetamidoacetyl)amino]benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 59722434 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | methyl (2R)-2-[[4-[(2-acetamidoacetyl)amino]benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@@H](CCSC)NC(=O)c1ccc(NC(=O)CNC(C)=O)cc1 |
| InChI | InChI=1S/C17H23N3O5S/c1-11(21)18-10-15(22)19-13-6-4-12(5-7-13)16(23)20-14(8-9-26-3)17(24)25-2/h4-7,14H,8-10H2,1-3H3,(H,18,21)(H,19,22)(H,20,23)/t14-/m1/s1 |
| InChIKey | NXCNRXYIDTUVJN-CQSZACIVSA-N |
| XLogP | 0.79 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |