C17H22N4O3S — CID 22862368
methyl (2S)-2-[[4-(1H-imidazol-5-ylmethylamino)benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 22862368) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is methyl (2S)-2-[[4-(1H-imidazol-5-ylmethylamino)benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[4-(1H-imidazol-5-ylmethylamino)benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 22862368 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | methyl (2S)-2-[[4-(1H-imidazol-5-ylmethylamino)benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)c1ccc(NCc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C17H22N4O3S/c1-24-17(23)15(7-8-25-2)21-16(22)12-3-5-13(6-4-12)19-10-14-9-18-11-20-14/h3-6,9,11,15,19H,7-8,10H2,1-2H3,(H,18,20)(H,21,22)/t15-/m0/s1 |
| InChIKey | QHWWNHNSKBZIHU-HNNXBMFYSA-N |
| XLogP | 2.05 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |