C23H26N2O5S — CID 3324397
[1-(4-acetylanilino)-1-oxopropan-2-yl] 2-benzamido-4-methylsulfanylbutanoate (PubChem CID 3324397) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is [1-(4-acetylanilino)-1-oxopropan-2-yl] 2-benzamido-4-methylsulfanylbutanoate.
| Compound Name | [1-(4-acetylanilino)-1-oxopropan-2-yl] 2-benzamido-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 3324397 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [1-(4-acetylanilino)-1-oxopropan-2-yl] 2-benzamido-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=O)c1ccccc1)C(=O)OC(C)C(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C23H26N2O5S/c1-15(26)17-9-11-19(12-10-17)24-21(27)16(2)30-23(29)20(13-14-31-3)25-22(28)18-7-5-4-6-8-18/h4-12,16,20H,13-14H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | VJAPQVGPJLQTMF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |