C14H16ClN3O2S — CID 108777993
2-[(3-chloroquinoxalin-2-yl)amino]-4-ethylsulfanylbutanoic acid (PubChem CID 108777993) has the molecular formula C14H16ClN3O2S and a molecular weight of 325.82 g/mol. Its IUPAC name is 2-[(3-chloroquinoxalin-2-yl)amino]-4-ethylsulfanylbutanoic acid.
| Compound Name | 2-[(3-chloroquinoxalin-2-yl)amino]-4-ethylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108777993 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-[(3-chloroquinoxalin-2-yl)amino]-4-ethylsulfanylbutanoic acid |
| SMILES | CCSCCC(Nc1nc2ccccc2nc1Cl)C(=O)O |
| InChI | InChI=1S/C14H16ClN3O2S/c1-2-21-8-7-11(14(19)20)18-13-12(15)16-9-5-3-4-6-10(9)17-13/h3-6,11H,2,7-8H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | CDHPDRWMXHPXHF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|