C20H22F3NO3S — CID 170770210
2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(4-phenylphenyl)butyl]sulfanylbutanoic acid (PubChem CID 170770210) has the molecular formula C20H22F3NO3S and a molecular weight of 413.46 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(4-phenylphenyl)butyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(4-phenylphenyl)butyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770210 |
| Molecular Formula | C20H22F3NO3S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(4-phenylphenyl)butyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(O)(c1ccc(-c2ccccc2)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C20H22F3NO3S/c21-20(22,23)19(27,11-13-28-12-10-17(24)18(25)26)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-9,17,27H,10-13,24H2,(H,25,26) |
| InChIKey | SEWYQUNCYKZYAS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|