C22H28F3NO3S — CID 170770392
2-amino-4-[4,4,4-trifluoro-3-[4-(2-hydroxyphenyl)phenyl]butyl]sulfanylbutanoic acid;ethane (PubChem CID 170770392) has the molecular formula C22H28F3NO3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-[4-(2-hydroxyphenyl)phenyl]butyl]sulfanylbutanoic acid;ethane.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-[4-(2-hydroxyphenyl)phenyl]butyl]sulfanylbutanoic acid;ethane |
|---|---|
| PubChem CID | 170770392 |
| Molecular Formula | C22H28F3NO3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-[4-(2-hydroxyphenyl)phenyl]butyl]sulfanylbutanoic acid;ethane |
| SMILES | CC.NC(CCSCCC(c1ccc(-c2ccccc2O)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C20H22F3NO3S.C2H6/c21-20(22,23)16(9-11-28-12-10-17(24)19(26)27)14-7-5-13(6-8-14)15-3-1-2-4-18(15)25;1-2/h1-8,16-17,25H,9-12,24H2,(H,26,27);1-2H3 |
| InChIKey | ISWALOQOILMYFK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|