C14H21F3N4O2S — CID 170769933
2-amino-4-[3-(3-amino-4-hydrazinylphenyl)-4,4,4-trifluorobutyl]sulfanylbutanoic acid (PubChem CID 170769933) has the molecular formula C14H21F3N4O2S and a molecular weight of 366.41 g/mol. Its IUPAC name is 2-amino-4-[3-(3-amino-4-hydrazinylphenyl)-4,4,4-trifluorobutyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[3-(3-amino-4-hydrazinylphenyl)-4,4,4-trifluorobutyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170769933 |
| Molecular Formula | C14H21F3N4O2S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-amino-4-[3-(3-amino-4-hydrazinylphenyl)-4,4,4-trifluorobutyl]sulfanylbutanoic acid |
| SMILES | NNc1ccc(C(CCSCCC(N)C(=O)O)C(F)(F)F)cc1N |
| InChI | InChI=1S/C14H21F3N4O2S/c15-14(16,17)9(3-5-24-6-4-10(18)13(22)23)8-1-2-12(21-20)11(19)7-8/h1-2,7,9-10,21H,3-6,18-20H2,(H,22,23) |
| InChIKey | NYKXQCOBKXHBPF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|