C17H22F3NO2S — CID 170770188
2-amino-4-[4,4,4-trifluoro-3-(4-prop-1-en-2-ylphenyl)butyl]sulfanylbutanoic acid (PubChem CID 170770188) has the molecular formula C17H22F3NO2S and a molecular weight of 361.43 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-(4-prop-1-en-2-ylphenyl)butyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-(4-prop-1-en-2-ylphenyl)butyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770188 |
| Molecular Formula | C17H22F3NO2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-(4-prop-1-en-2-ylphenyl)butyl]sulfanylbutanoic acid |
| SMILES | C=C(C)c1ccc(C(CCSCCC(N)C(=O)O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H22F3NO2S/c1-11(2)12-3-5-13(6-4-12)14(17(18,19)20)7-9-24-10-8-15(21)16(22)23/h3-6,14-15H,1,7-10,21H2,2H3,(H,22,23) |
| InChIKey | ZNIHHSNWZLULDL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|