C21H22F3N3O2S — CID 170770169
2-amino-4-[4,4,4-trifluoro-3-[4-(1H-indazol-6-yl)phenyl]butyl]sulfanylbutanoic acid (PubChem CID 170770169) has the molecular formula C21H22F3N3O2S and a molecular weight of 437.49 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-[4-(1H-indazol-6-yl)phenyl]butyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-[4-(1H-indazol-6-yl)phenyl]butyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770169 |
| Molecular Formula | C21H22F3N3O2S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-[4-(1H-indazol-6-yl)phenyl]butyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(c1ccc(-c2ccc3cn[nH]c3c2)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C21H22F3N3O2S/c22-21(23,24)17(7-9-30-10-8-18(25)20(28)29)14-3-1-13(2-4-14)15-5-6-16-12-26-27-19(16)11-15/h1-6,11-12,17-18H,7-10,25H2,(H,26,27)(H,28,29) |
| InChIKey | LEMHBUWOXNPJCS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|