C10H15F3N4O2S — CID 170770012
2-amino-4-[4,4,4-trifluoro-3-(triazol-2-yl)butyl]sulfanylbutanoic acid (PubChem CID 170770012) has the molecular formula C10H15F3N4O2S and a molecular weight of 312.32 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-(triazol-2-yl)butyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-(triazol-2-yl)butyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770012 |
| Molecular Formula | C10H15F3N4O2S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-(triazol-2-yl)butyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(n1nccn1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H15F3N4O2S/c11-10(12,13)8(17-15-3-4-16-17)2-6-20-5-1-7(14)9(18)19/h3-4,7-8H,1-2,5-6,14H2,(H,18,19) |
| InChIKey | BVAYHHVUEMHAQZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|