C16H19F3N2O2S — CID 170770656
2-amino-4-[4,4,4-trifluoro-3-(1H-indol-3-yl)butyl]sulfanylbutanoic acid (PubChem CID 170770656) has the molecular formula C16H19F3N2O2S and a molecular weight of 360.40 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-(1H-indol-3-yl)butyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-(1H-indol-3-yl)butyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770656 |
| Molecular Formula | C16H19F3N2O2S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-(1H-indol-3-yl)butyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(c1c[nH]c2ccccc12)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C16H19F3N2O2S/c17-16(18,19)12(5-7-24-8-6-13(20)15(22)23)11-9-21-14-4-2-1-3-10(11)14/h1-4,9,12-13,21H,5-8,20H2,(H,22,23) |
| InChIKey | DWIDHSPCTNIIKG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|