C19H16F3NO3S — CID 11211598
(4S)-1-(benzenesulfonyl)-5,5,5-trifluoro-4-(1H-indol-3-yl)pentan-2-one (PubChem CID 11211598) has the molecular formula C19H16F3NO3S and a molecular weight of 395.40 g/mol. Its IUPAC name is (4S)-1-(benzenesulfonyl)-5,5,5-trifluoro-4-(1H-indol-3-yl)pentan-2-one.
| Compound Name | (4S)-1-(benzenesulfonyl)-5,5,5-trifluoro-4-(1H-indol-3-yl)pentan-2-one |
|---|---|
| PubChem CID | 11211598 |
| Molecular Formula | C19H16F3NO3S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | (4S)-1-(benzenesulfonyl)-5,5,5-trifluoro-4-(1H-indol-3-yl)pentan-2-one |
| SMILES | O=C(C[C@@H](c1c[nH]c2ccccc12)C(F)(F)F)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H16F3NO3S/c20-19(21,22)17(16-11-23-18-9-5-4-8-15(16)18)10-13(24)12-27(25,26)14-6-2-1-3-7-14/h1-9,11,17,23H,10,12H2/t17-/m0/s1 |
| InChIKey | OWTMHQXCOFBOEB-KRWDZBQOSA-N |
| XLogP | 4.25 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |