C14H11Cl3F3NO2 — CID 15364996
2,2,2-trichloroethyl (3R)-4,4,4-trifluoro-3-(1H-indol-3-yl)butanoate (PubChem CID 15364996) has the molecular formula C14H11Cl3F3NO2 and a molecular weight of 388.60 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (3R)-4,4,4-trifluoro-3-(1H-indol-3-yl)butanoate.
| Compound Name | 2,2,2-trichloroethyl (3R)-4,4,4-trifluoro-3-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 15364996 |
| Molecular Formula | C14H11Cl3F3NO2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | 2,2,2-trichloroethyl (3R)-4,4,4-trifluoro-3-(1H-indol-3-yl)butanoate |
| SMILES | O=C(C[C@H](c1c[nH]c2ccccc12)C(F)(F)F)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H11Cl3F3NO2/c15-13(16,17)7-23-12(22)5-10(14(18,19)20)9-6-21-11-4-2-1-3-8(9)11/h1-4,6,10,21H,5,7H2/t10-/m1/s1 |
| InChIKey | FHUFIJKZJUPPEU-SNVBAGLBSA-N |
| XLogP | 5.12 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|