C21H23ClF3NO2S — CID 170770694
2-amino-4-[3-[4-(3-chloro-5-methylphenyl)phenyl]-4,4,4-trifluorobutyl]sulfanylbutanoic acid (PubChem CID 170770694) has the molecular formula C21H23ClF3NO2S and a molecular weight of 445.93 g/mol. Its IUPAC name is 2-amino-4-[3-[4-(3-chloro-5-methylphenyl)phenyl]-4,4,4-trifluorobutyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[3-[4-(3-chloro-5-methylphenyl)phenyl]-4,4,4-trifluorobutyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770694 |
| Molecular Formula | C21H23ClF3NO2S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 2-amino-4-[3-[4-(3-chloro-5-methylphenyl)phenyl]-4,4,4-trifluorobutyl]sulfanylbutanoic acid |
| SMILES | Cc1cc(Cl)cc(-c2ccc(C(CCSCCC(N)C(=O)O)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C21H23ClF3NO2S/c1-13-10-16(12-17(22)11-13)14-2-4-15(5-3-14)18(21(23,24)25)6-8-29-9-7-19(26)20(27)28/h2-5,10-12,18-19H,6-9,26H2,1H3,(H,27,28) |
| InChIKey | IGXQXTDMEGZWPF-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|