C7H11N3O3S — CID 60929998
2-amino-4-(1,2,4-oxadiazol-3-ylmethylsulfanyl)butanoic acid (PubChem CID 60929998) has the molecular formula C7H11N3O3S and a molecular weight of 217.25 g/mol. Its IUPAC name is 2-amino-4-(1,2,4-oxadiazol-3-ylmethylsulfanyl)butanoic acid.
| Compound Name | 2-amino-4-(1,2,4-oxadiazol-3-ylmethylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 60929998 |
| Molecular Formula | C7H11N3O3S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 2-amino-4-(1,2,4-oxadiazol-3-ylmethylsulfanyl)butanoic acid |
| SMILES | NC(CCSCc1ncon1)C(=O)O |
| InChI | InChI=1S/C7H11N3O3S/c8-5(7(11)12)1-2-14-3-6-9-4-13-10-6/h4-5H,1-3,8H2,(H,11,12) |
| InChIKey | DXFJOQRFAXEKPK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|