(2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid

C6H9N3O3S — CID 61141696

IUPAC(2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid
SMILESN[C@@H](CSCc1ncon1)C(=O)O
InChIInChI=1S/C6H9N3O3S/c7-4(6(10)11)1-13-2-5-8-3-12-9-5/h3-4H,1-2,7H2,(H,10,11)/t4-/m0/s1
InChIKeyNLBBXXYWOOOAKN-BYPYZUCNSA-N
MW203.22 g/mol
LogP-0.29
Rot. Bonds5

About (2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid

(2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid (PubChem CID 61141696) has the molecular formula C6H9N3O3S and a molecular weight of 203.22 g/mol. Its IUPAC name is (2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid.

Molecular Properties

Compound Name(2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid
PubChem CID61141696
Molecular FormulaC6H9N3O3S
Molecular Weight203.22 g/mol
Exact Mass203.04
IUPAC Name(2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid
SMILESN[C@@H](CSCc1ncon1)C(=O)O
InChIInChI=1S/C6H9N3O3S/c7-4(6(10)11)1-13-2-5-8-3-12-9-5/h3-4H,1-2,7H2,(H,10,11)/t4-/m0/s1
InChIKeyNLBBXXYWOOOAKN-BYPYZUCNSA-N
XLogP-0.29
TPSA102.24 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.22
LogP ≤ 5-0.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze (2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid?
The IUPAC name of (2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid (CID 61141696) is (2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid.
What is the SMILES notation for (2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid?
The canonical SMILES for (2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid is N[C@@H](CSCc1ncon1)C(=O)O.
What is the InChIKey of (2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid?
The InChIKey is NLBBXXYWOOOAKN-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H9N3O3S/c7-4(6(10)11)1-13-2-5-8-3-12-9-5/h3-4H,1-2,7H2,(H,10,11)/t4-/m0/s1.
What are the key properties of (2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid?
(2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid has a molecular weight of 203.22 g/mol, XLogP of -0.29, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-(1,2,4-oxadiazol-3-ylmethylsulfanyl)propanoic acid is sourced from PubChem (CID 61141696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).