C6H11N5O2S — CID 107043232
(2R)-2-amino-3-[(2-methyltetrazol-5-yl)methylsulfanyl]propanoic acid (PubChem CID 107043232) has the molecular formula C6H11N5O2S and a molecular weight of 217.25 g/mol. Its IUPAC name is (2R)-2-amino-3-[(2-methyltetrazol-5-yl)methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[(2-methyltetrazol-5-yl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 107043232 |
| Molecular Formula | C6H11N5O2S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | (2R)-2-amino-3-[(2-methyltetrazol-5-yl)methylsulfanyl]propanoic acid |
| SMILES | Cn1nnc(CSC[C@H](N)C(=O)O)n1 |
| InChI | InChI=1S/C6H11N5O2S/c1-11-9-5(8-10-11)3-14-2-4(7)6(12)13/h4H,2-3,7H2,1H3,(H,12,13)/t4-/m0/s1 |
| InChIKey | IUFPGMMGVOZEKV-BYPYZUCNSA-N |
| XLogP | -1.14 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |