C9H17N5O2 — CID 107067051
2-(aminomethyl)-3-methyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid (PubChem CID 107067051) has the molecular formula C9H17N5O2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-(aminomethyl)-3-methyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid.
| Compound Name | 2-(aminomethyl)-3-methyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid |
|---|---|
| PubChem CID | 107067051 |
| Molecular Formula | C9H17N5O2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-(aminomethyl)-3-methyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid |
| SMILES | CC(C)C(CN)(Cc1nnn(C)n1)C(=O)O |
| InChI | InChI=1S/C9H17N5O2/c1-6(2)9(5-10,8(15)16)4-7-11-13-14(3)12-7/h6H,4-5,10H2,1-3H3,(H,15,16) |
| InChIKey | ZJBFDKPZPHLUFQ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |