C7H12N4O2 — CID 106397147
(2S)-2-amino-N-(1,2,4-oxadiazol-3-ylmethyl)butanamide (PubChem CID 106397147) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is (2S)-2-amino-N-(1,2,4-oxadiazol-3-ylmethyl)butanamide.
| Compound Name | (2S)-2-amino-N-(1,2,4-oxadiazol-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 106397147 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (2S)-2-amino-N-(1,2,4-oxadiazol-3-ylmethyl)butanamide |
| SMILES | CC[C@H](N)C(=O)NCc1ncon1 |
| InChI | InChI=1S/C7H12N4O2/c1-2-5(8)7(12)9-3-6-10-4-13-11-6/h4-5H,2-3,8H2,1H3,(H,9,12)/t5-/m0/s1 |
| InChIKey | KLWCVQBAVPQZKI-YFKPBYRVSA-N |
| XLogP | -0.58 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |