C7H9ClN4O3 — CID 106405226
2-chloro-N-(1,2,4-oxadiazol-3-ylmethylcarbamoyl)propanamide (PubChem CID 106405226) has the molecular formula C7H9ClN4O3 and a molecular weight of 232.63 g/mol. Its IUPAC name is 2-chloro-N-(1,2,4-oxadiazol-3-ylmethylcarbamoyl)propanamide.
| Compound Name | 2-chloro-N-(1,2,4-oxadiazol-3-ylmethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 106405226 |
| Molecular Formula | C7H9ClN4O3 |
| Molecular Weight | 232.63 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 2-chloro-N-(1,2,4-oxadiazol-3-ylmethylcarbamoyl)propanamide |
| SMILES | CC(Cl)C(=O)NC(=O)NCc1ncon1 |
| InChI | InChI=1S/C7H9ClN4O3/c1-4(8)6(13)11-7(14)9-2-5-10-3-15-12-5/h3-4H,2H2,1H3,(H2,9,11,13,14) |
| InChIKey | GEMKYMXPTMPCMM-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.63 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|