C7H9N3O3 — CID 106398468
N-(1,2,4-oxadiazol-3-ylmethyl)-3-oxobutanamide (PubChem CID 106398468) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)-3-oxobutanamide.
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 106398468 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NCc1ncon1 |
| InChI | InChI=1S/C7H9N3O3/c1-5(11)2-7(12)8-3-6-9-4-13-10-6/h4H,2-3H2,1H3,(H,8,12) |
| InChIKey | ZJWKZJLULJOEKM-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|