C12H14N4O4 — CID 106396967
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide (PubChem CID 106396967) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 106396967 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide |
| SMILES | N[C@@H](Cc1ccc(O)c(O)c1)C(=O)NCc1ncon1 |
| InChI | InChI=1S/C12H14N4O4/c13-8(3-7-1-2-9(17)10(18)4-7)12(19)14-5-11-15-6-20-16-11/h1-2,4,6,8,17-18H,3,5,13H2,(H,14,19)/t8-/m0/s1 |
| InChIKey | SFHDVCOPDWGFKL-QMMMGPOBSA-N |
| XLogP | -0.33 |
| TPSA | 134.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|