C8H11NO2S2 — CID 36690947
(2S)-2-amino-3-(thiophen-2-ylmethylsulfanyl)propanoic acid (PubChem CID 36690947) has the molecular formula C8H11NO2S2 and a molecular weight of 217.31 g/mol. Its IUPAC name is (2S)-2-amino-3-(thiophen-2-ylmethylsulfanyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(thiophen-2-ylmethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 36690947 |
| Molecular Formula | C8H11NO2S2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | (2S)-2-amino-3-(thiophen-2-ylmethylsulfanyl)propanoic acid |
| SMILES | N[C@H](CSCc1cccs1)C(=O)O |
| InChI | InChI=1S/C8H11NO2S2/c9-7(8(10)11)5-12-4-6-2-1-3-13-6/h1-3,7H,4-5,9H2,(H,10,11)/t7-/m1/s1 |
| InChIKey | SYRYKNATHQOKRT-SSDOTTSWSA-N |
| XLogP | 1.39 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |