C17H24N2S2 — CID 65128705
N-ethyl-1-phenyl-2-[2-(propylsulfanylmethyl)-1,3-thiazol-4-yl]ethanamine (PubChem CID 65128705) has the molecular formula C17H24N2S2 and a molecular weight of 320.53 g/mol. Its IUPAC name is N-ethyl-1-phenyl-2-[2-(propylsulfanylmethyl)-1,3-thiazol-4-yl]ethanamine.
| Compound Name | N-ethyl-1-phenyl-2-[2-(propylsulfanylmethyl)-1,3-thiazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 65128705 |
| Molecular Formula | C17H24N2S2 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-ethyl-1-phenyl-2-[2-(propylsulfanylmethyl)-1,3-thiazol-4-yl]ethanamine |
| SMILES | CCCSCc1nc(CC(NCC)c2ccccc2)cs1 |
| InChI | InChI=1S/C17H24N2S2/c1-3-10-20-13-17-19-15(12-21-17)11-16(18-4-2)14-8-6-5-7-9-14/h5-9,12,16,18H,3-4,10-11,13H2,1-2H3 |
| InChIKey | XODHSARBVPZOMD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|