C9H11NO2S — CID 82054960
2-[2-(2-methylprop-2-enyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 82054960) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enyl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(2-methylprop-2-enyl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 82054960 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 2-[2-(2-methylprop-2-enyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | C=C(C)Cc1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C9H11NO2S/c1-6(2)3-8-10-7(5-13-8)4-9(11)12/h5H,1,3-4H2,2H3,(H,11,12) |
| InChIKey | IQIGMJPTNWBUNJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|